C12H18 — CID 143721381
(1S,2S,3R,6R,7R,8S,10S)-3-methyltetracyclo[5.4.0.02,6.08,10]undecane (PubChem CID 143721381) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (1S,2S,3R,6R,7R,8S,10S)-3-methyltetracyclo[5.4.0.02,6.08,10]undecane.
| Compound Name | (1S,2S,3R,6R,7R,8S,10S)-3-methyltetracyclo[5.4.0.02,6.08,10]undecane |
|---|---|
| PubChem CID | 143721381 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (1S,2S,3R,6R,7R,8S,10S)-3-methyltetracyclo[5.4.0.02,6.08,10]undecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]3[C@@H](C[C@@H]4C[C@@H]43)[C@H]21 |
| InChI | InChI=1S/C12H18/c1-6-2-3-8-11(6)10-5-7-4-9(7)12(8)10/h6-12H,2-5H2,1H3/t6-,7+,8-,9+,10+,11+,12+/m1/s1 |
| InChIKey | MDIZOAHVFVGUKE-CEDBYBORSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |