C11H14 — CID 163852923
(6R)-pentacyclo[5.4.0.02,6.03,5.08,10]undecane (PubChem CID 163852923) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (6R)-pentacyclo[5.4.0.02,6.03,5.08,10]undecane.
| Compound Name | (6R)-pentacyclo[5.4.0.02,6.03,5.08,10]undecane |
|---|---|
| PubChem CID | 163852923 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (6R)-pentacyclo[5.4.0.02,6.03,5.08,10]undecane |
| SMILES | C1C2CC3C(C12)[C@@H]1C2CC2C31 |
| InChI | InChI=1S/C11H14/c1-4-2-8-9(5(1)4)11-7-3-6(7)10(8)11/h4-11H,1-3H2/t4?,5?,6?,7?,8?,9?,10?,11-/m0/s1 |
| InChIKey | OVXCDRXXGLPYLH-OZZCVZQFSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |