About heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane
heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane (PubChem CID 59938675) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane.
Analyze heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane?
The IUPAC name of heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane (CID 59938675) is heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane.
What is the SMILES notation for heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane?
The canonical SMILES for heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane is C1C2CC3C1C1CC(C4CC5C6CC2CC6C54)C31.
What is the InChIKey of heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane?
The InChIKey is MVFOXXJLNYBTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24/c1-7-3-11-9(1)13-5-15(17(11)13)16-6-14-10-2-8(7)4-12(10)18(14)16/h7-18H,1-6H2.
What are the key properties of heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane?
heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane has a molecular weight of 240.39 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptacyclo[12.2.1.110,13.02,5.03,16.06,9.08,11]octadecane is sourced from PubChem (CID 59938675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).