About 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane
3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane (PubChem CID 15498999) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane.
Molecular Properties
| Compound Name | 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane |
| PubChem CID | 15498999 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane |
| SMILES | C1C2CC3C1C3C2OC1C2CC3C(C2)C31 |
| InChI | InChI=1S/C14H18O/c1-5-2-8-7(1)11(8)13(5)15-14-6-3-9-10(4-6)12(9)14/h5-14H,1-4H2 |
| InChIKey | XSQRDRJZFZHPQI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane?
The IUPAC name of 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane (CID 15498999) is 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane.
What is the SMILES notation for 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane?
The canonical SMILES for 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane is C1C2CC3C1C3C2OC1C2CC3C(C2)C31.
What is the InChIKey of 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane?
The InChIKey is XSQRDRJZFZHPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-5-2-8-7(1)11(8)13(5)15-14-6-3-9-10(4-6)12(9)14/h5-14H,1-4H2.
What are the key properties of 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane?
3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane has a molecular weight of 202.30 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tricyclo[2.2.1.02,6]heptanyloxy)tricyclo[2.2.1.02,6]heptane is sourced from PubChem (CID 15498999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).