C13H20 — CID 59892974
(2R,5R,11R)-tetracyclo[6.4.1.02,5.011,13]tridecane (PubChem CID 59892974) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (2R,5R,11R)-tetracyclo[6.4.1.02,5.011,13]tridecane.
| Compound Name | (2R,5R,11R)-tetracyclo[6.4.1.02,5.011,13]tridecane |
|---|---|
| PubChem CID | 59892974 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (2R,5R,11R)-tetracyclo[6.4.1.02,5.011,13]tridecane |
| SMILES | C1C[C@@H]2CC3C2C1CC[C@H]1CC[C@@H]31 |
| InChI | InChI=1S/C13H20/c1-2-9-3-4-10-7-12(13(9)10)11-6-5-8(1)11/h8-13H,1-7H2/t8-,9?,10+,11+,12?,13?/m0/s1 |
| InChIKey | GPMAKPYXVSCXDD-NDWJTDFDSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |