C8H10 — CID 12871558
tetracyclo[5.1.0.02,4.03,5]octane (PubChem CID 12871558) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is tetracyclo[5.1.0.02,4.03,5]octane.
| Compound Name | tetracyclo[5.1.0.02,4.03,5]octane |
|---|---|
| PubChem CID | 12871558 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | tetracyclo[5.1.0.02,4.03,5]octane |
| SMILES | C1C2CC3C4C(C12)C34 |
| InChI | InChI=1S/C8H10/c1-3-2-5-7-6(4(1)3)8(5)7/h3-8H,1-2H2 |
| InChIKey | HUSGFIAKPIKLBZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |