About hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine
hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine (PubChem CID 134863739) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine.
Analyze hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine?
The IUPAC name of hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine (CID 134863739) is hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine.
What is the SMILES notation for hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine?
The canonical SMILES for hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine is NC1C2CC3C(C2)C2C4CC5C2C5C4C13.
What is the InChIKey of hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine?
The InChIKey is IKVAXSJFHRJYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c15-14-4-1-5-6(2-4)13(14)12-7-3-8-10(9(5)7)11(8)12/h4-14H,1-3,15H2.
What are the key properties of hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine?
hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine has a molecular weight of 201.31 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexacyclo[9.2.1.02,7.03,5.04,8.09,13]tetradecan-10-amine is sourced from PubChem (CID 134863739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).