C15H24N2 — CID 139623420
pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-4,12-diamine (PubChem CID 139623420) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-4,12-diamine.
| Compound Name | pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-4,12-diamine |
|---|---|
| PubChem CID | 139623420 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | pentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-4,12-diamine |
| SMILES | NC1CC2CC1C1C3CC(C4CCC(N)C43)C21 |
| InChI | InChI=1S/C15H24N2/c16-11-2-1-7-8-5-10(14(7)11)15-9-3-6(13(8)15)4-12(9)17/h6-15H,1-5,16-17H2 |
| InChIKey | MJLDZOSDNQWIJL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|