C10H14 — CID 146782655
tetracyclo[4.4.0.02,7.03,8]decane (PubChem CID 146782655) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is tetracyclo[4.4.0.02,7.03,8]decane.
| Compound Name | tetracyclo[4.4.0.02,7.03,8]decane |
|---|---|
| PubChem CID | 146782655 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | tetracyclo[4.4.0.02,7.03,8]decane |
| SMILES | C1CC2C3CCC4C1C3C42 |
| InChI | InChI=1S/C10H14/c1-2-6-8-4-3-7-5(1)9(8)10(6)7/h5-10H,1-4H2 |
| InChIKey | XQOHEQRCVNNTSX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |