C18H30 — CID 160503054
ethane;hexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane (PubChem CID 160503054) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is ethane;hexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane.
| Compound Name | ethane;hexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane |
|---|---|
| PubChem CID | 160503054 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | ethane;hexacyclo[6.6.0.02,7.03,6.09,14.010,13]tetradecane |
| SMILES | C1CC2C1C1C2C2C3C4CCC4C3C12.CC.CC |
| InChI | InChI=1S/C14H18.2C2H6/c1-2-6-5(1)9-10(6)14-12-8-4-3-7(8)11(12)13(9)14;2*1-2/h5-14H,1-4H2;2*1-2H3 |
| InChIKey | QSAPYZOUNGWQRZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|