About cubane;ethane
cubane;ethane (PubChem CID 163673038) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is cubane;ethane.
Molecular Properties
| Compound Name | cubane;ethane |
| PubChem CID | 163673038 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | cubane;ethane |
| SMILES | C12C3C4C1C1C2C3C41.CC |
| InChI | InChI=1S/C8H8.C2H6/c1-2-5-3(1)7-4(1)6(2)8(5)7;1-2/h1-8H;1-2H3 |
| InChIKey | JEFRBBHJSHCYLB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cubane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cubane;ethane?
The IUPAC name of cubane;ethane (CID 163673038) is cubane;ethane.
What is the SMILES notation for cubane;ethane?
The canonical SMILES for cubane;ethane is C12C3C4C1C1C2C3C41.CC.
What is the InChIKey of cubane;ethane?
The InChIKey is JEFRBBHJSHCYLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C2H6/c1-2-5-3(1)7-4(1)6(2)8(5)7;1-2/h1-8H;1-2H3.
What are the key properties of cubane;ethane?
cubane;ethane has a molecular weight of 134.22 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cubane;ethane is sourced from PubChem (CID 163673038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).