C11H16 — CID 163896911
(7S,8S)-tetracyclo[5.4.0.02,6.08,11]undecane (PubChem CID 163896911) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (7S,8S)-tetracyclo[5.4.0.02,6.08,11]undecane.
| Compound Name | (7S,8S)-tetracyclo[5.4.0.02,6.08,11]undecane |
|---|---|
| PubChem CID | 163896911 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (7S,8S)-tetracyclo[5.4.0.02,6.08,11]undecane |
| SMILES | C1CC2C(C1)[C@@H]1C2C2CC[C@@H]21 |
| InChI | InChI=1S/C11H16/c1-2-6-7(3-1)11-9-5-4-8(9)10(6)11/h6-11H,1-5H2/t6?,7?,8-,9?,10-,11?/m0/s1 |
| InChIKey | QGLBZGXUPGASTF-VLOBIDSLSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |