C10H16O — CID 39353118
(1S,2R,3R,6R,7R)-tricyclo[5.3.0.02,6]decan-3-ol (PubChem CID 39353118) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1S,2R,3R,6R,7R)-tricyclo[5.3.0.02,6]decan-3-ol.
| Compound Name | (1S,2R,3R,6R,7R)-tricyclo[5.3.0.02,6]decan-3-ol |
|---|---|
| PubChem CID | 39353118 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1S,2R,3R,6R,7R)-tricyclo[5.3.0.02,6]decan-3-ol |
| SMILES | O[C@@H]1CC[C@@H]2[C@@H]3CCC[C@@H]3[C@H]21 |
| InChI | InChI=1S/C10H16O/c11-9-5-4-8-6-2-1-3-7(6)10(8)9/h6-11H,1-5H2/t6-,7+,8-,9-,10-/m1/s1 |
| InChIKey | ZJXDTPDTKHSVBH-JDDHQFAOSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |