C6H11NO — CID 83814962
(1R,6R)-6-aminobicyclo[3.1.0]hexan-2-ol (PubChem CID 83814962) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (1R,6R)-6-aminobicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,6R)-6-aminobicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 83814962 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (1R,6R)-6-aminobicyclo[3.1.0]hexan-2-ol |
| SMILES | N[C@@H]1C2CCC(O)[C@H]21 |
| InChI | InChI=1S/C6H11NO/c7-6-3-1-2-4(8)5(3)6/h3-6,8H,1-2,7H2/t3?,4?,5-,6+/m0/s1 |
| InChIKey | JDYYEAXXIZDYRF-QGLADZMWSA-N |
| XLogP | -0.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |