C6H14N2O2 — CID 14760875
2,4-diaminocyclohexane-1,3-diol (PubChem CID 14760875) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,4-diaminocyclohexane-1,3-diol.
| Compound Name | 2,4-diaminocyclohexane-1,3-diol |
|---|---|
| PubChem CID | 14760875 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2,4-diaminocyclohexane-1,3-diol |
| SMILES | NC1CCC(O)C(N)C1O |
| InChI | InChI=1S/C6H14N2O2/c7-3-1-2-4(9)5(8)6(3)10/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | JTYOAYBZSGVACH-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |