C5H12N2O2 — CID 11356181
(1S,2R,3R,4S)-3,4-diaminocyclopentane-1,2-diol (PubChem CID 11356181) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3,4-diaminocyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,4S)-3,4-diaminocyclopentane-1,2-diol |
|---|---|
| PubChem CID | 11356181 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (1S,2R,3R,4S)-3,4-diaminocyclopentane-1,2-diol |
| SMILES | N[C@H]1[C@@H](O)[C@@H](O)C[C@@H]1N |
| InChI | InChI=1S/C5H12N2O2/c6-2-1-3(8)5(9)4(2)7/h2-5,8-9H,1,6-7H2/t2-,3-,4+,5-/m0/s1 |
| InChIKey | SPUJACCASZGKBX-KLVWXMOXSA-N |
| XLogP | -2.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |