C6H14N2O3 — CID 11160674
(1S,2R,3S,4R,5S)-4,5-diaminocyclohexane-1,2,3-triol (PubChem CID 11160674) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4,5-diaminocyclohexane-1,2,3-triol.
| Compound Name | (1S,2R,3S,4R,5S)-4,5-diaminocyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11160674 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4,5-diaminocyclohexane-1,2,3-triol |
| SMILES | N[C@H]1[C@H](O)[C@H](O)[C@@H](O)C[C@@H]1N |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-3(9)5(10)6(11)4(2)8/h2-6,9-11H,1,7-8H2/t2-,3-,4+,5+,6-/m0/s1 |
| InChIKey | MLAHPGPQFHMHMX-YJRYQGEOSA-N |
| XLogP | -2.87 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |