C6H14N2O3 — CID 25245099
cis-(4S,6R)-4,6-diaminocyclohexane-1,2,3-triol (PubChem CID 25245099) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is cis-(4S,6R)-4,6-diaminocyclohexane-1,2,3-triol.
| Compound Name | cis-(4S,6R)-4,6-diaminocyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 25245099 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | cis-(4S,6R)-4,6-diaminocyclohexane-1,2,3-triol |
| SMILES | N[C@@H]1C[C@H](N)C(O)C(O)C1O |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,9-11H,1,7-8H2/t2-,3+,4?,5?,6? |
| InChIKey | DTFAJAKTSMLKAT-DZQXHIEHSA-N |
| XLogP | -2.87 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |