C6H13FN2O2 — CID 142537536
(1R)-4,6-diamino-3-fluorocyclohexane-1,2-diol (PubChem CID 142537536) has the molecular formula C6H13FN2O2 and a molecular weight of 164.18 g/mol. Its IUPAC name is (1R)-4,6-diamino-3-fluorocyclohexane-1,2-diol.
| Compound Name | (1R)-4,6-diamino-3-fluorocyclohexane-1,2-diol |
|---|---|
| PubChem CID | 142537536 |
| Molecular Formula | C6H13FN2O2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (1R)-4,6-diamino-3-fluorocyclohexane-1,2-diol |
| SMILES | NC1CC(N)[C@@H](O)C(O)C1F |
| InChI | InChI=1S/C6H13FN2O2/c7-4-2(8)1-3(9)5(10)6(4)11/h2-6,10-11H,1,8-9H2/t2?,3?,4?,5-,6?/m1/s1 |
| InChIKey | ULWLXMDKKYHPOR-ZZRYAAOLSA-N |
| XLogP | -1.90 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |