C5H11FN2O — CID 102050550
(1S,2S,3S,5R)-3,5-diamino-2-fluorocyclopentan-1-ol (PubChem CID 102050550) has the molecular formula C5H11FN2O and a molecular weight of 134.15 g/mol. Its IUPAC name is (1S,2S,3S,5R)-3,5-diamino-2-fluorocyclopentan-1-ol.
| Compound Name | (1S,2S,3S,5R)-3,5-diamino-2-fluorocyclopentan-1-ol |
|---|---|
| PubChem CID | 102050550 |
| Molecular Formula | C5H11FN2O |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | (1S,2S,3S,5R)-3,5-diamino-2-fluorocyclopentan-1-ol |
| SMILES | N[C@@H]1C[C@H](N)[C@H](F)[C@H]1O |
| InChI | InChI=1S/C5H11FN2O/c6-4-2(7)1-3(8)5(4)9/h2-5,9H,1,7-8H2/t2-,3+,4-,5-/m0/s1 |
| InChIKey | WPCDXDCVQZYGLU-QTBDOELSSA-N |
| XLogP | -1.26 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |