C5H11NO2 — CID 11768778
trans-(1R,3R)-2-aminocyclopentane-1,3-diol (PubChem CID 11768778) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is trans-(1R,3R)-2-aminocyclopentane-1,3-diol.
| Compound Name | trans-(1R,3R)-2-aminocyclopentane-1,3-diol |
|---|---|
| PubChem CID | 11768778 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | trans-(1R,3R)-2-aminocyclopentane-1,3-diol |
| SMILES | NC1[C@H](O)CC[C@H]1O |
| InChI | InChI=1S/C5H11NO2/c6-5-3(7)1-2-4(5)8/h3-5,7-8H,1-2,6H2/t3-,4-/m1/s1 |
| InChIKey | IKOXIDCLHJCBMV-QWWZWVQMSA-N |
| XLogP | -1.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |