C18H24I2O2 — CID 98556858
(1S,2R,3S,6R,7R,8R,9R,10S,11S,14S,15S,16R,17R,18R)-8,18-diiodohexacyclo[13.2.1.02,6.07,17.09,16.010,14]octadecane-3,11-diol (PubChem CID 98556858) has the molecular formula C18H24I2O2 and a molecular weight of 526.20 g/mol. Its IUPAC name is (1S,2R,3S,6R,7R,8R,9R,10S,11S,14S,15S,16R,17R,18R)-8,18-diiodohexacyclo[13.2.1.02,6.07,17.09,16.010,14]octadecane-3,11-diol.
| Compound Name | (1S,2R,3S,6R,7R,8R,9R,10S,11S,14S,15S,16R,17R,18R)-8,18-diiodohexacyclo[13.2.1.02,6.07,17.09,16.010,14]octadecane-3,11-diol |
|---|---|
| PubChem CID | 98556858 |
| Molecular Formula | C18H24I2O2 |
| Molecular Weight | 526.20 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | (1S,2R,3S,6R,7R,8R,9R,10S,11S,14S,15S,16R,17R,18R)-8,18-diiodohexacyclo[13.2.1.02,6.07,17.09,16.010,14]octadecane-3,11-diol |
| SMILES | O[C@H]1CC[C@H]2[C@H]3[C@@H](I)[C@@H]4[C@@H]5[C@H]3[C@H]([C@H](I)[C@H]5[C@H]3CC[C@H](O)[C@@H]34)[C@@H]21 |
| InChI | InChI=1S/C18H24I2O2/c19-17-11-5-1-3-7(21)9(5)15-13(11)14-12(18(15)20)6-2-4-8(22)10(6)16(14)17/h5-18,21-22H,1-4H2/t5-,6+,7-,8-,9+,10-,11-,12+,13-,14-,15-,16+,17+,18+/m0/s1 |
| InChIKey | QTTBMGMBEGMWKJ-YSFHPUCMSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|