C12H16O — CID 98556285
(1R,2R,3R,4R,5S,7R,8S,9R,10S)-pentacyclo[6.4.0.02,10.03,7.04,9]dodecan-5-ol (PubChem CID 98556285) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (1R,2R,3R,4R,5S,7R,8S,9R,10S)-pentacyclo[6.4.0.02,10.03,7.04,9]dodecan-5-ol.
| Compound Name | (1R,2R,3R,4R,5S,7R,8S,9R,10S)-pentacyclo[6.4.0.02,10.03,7.04,9]dodecan-5-ol |
|---|---|
| PubChem CID | 98556285 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1R,2R,3R,4R,5S,7R,8S,9R,10S)-pentacyclo[6.4.0.02,10.03,7.04,9]dodecan-5-ol |
| SMILES | O[C@H]1C[C@@H]2[C@@H]3[C@@H]4CC[C@H]5[C@@H]4[C@@H]2[C@H]1[C@H]53 |
| InChI | InChI=1S/C12H16O/c13-7-3-6-9-4-1-2-5-8(4)11(6)12(7)10(5)9/h4-13H,1-3H2/t4-,5+,6-,7+,8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | WFYBBUYHFFOKJP-RROBTUQGSA-N |
| XLogP | 1.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |