C12H16O2 — CID 124792530
(1R,2R,3S,4R,5R,7R,8R,9R,10R,12R)-pentacyclo[6.4.0.02,5.03,10.04,9]dodecane-7,12-diol (PubChem CID 124792530) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R,7R,8R,9R,10R,12R)-pentacyclo[6.4.0.02,5.03,10.04,9]dodecane-7,12-diol.
| Compound Name | (1R,2R,3S,4R,5R,7R,8R,9R,10R,12R)-pentacyclo[6.4.0.02,5.03,10.04,9]dodecane-7,12-diol |
|---|---|
| PubChem CID | 124792530 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R,2R,3S,4R,5R,7R,8R,9R,10R,12R)-pentacyclo[6.4.0.02,5.03,10.04,9]dodecane-7,12-diol |
| SMILES | O[C@@H]1C[C@@H]2[C@@H]3[C@@H]4[C@H]5C[C@@H](O)[C@H]([C@H]24)[C@H]1[C@H]53 |
| InChI | InChI=1S/C12H16O2/c13-5-1-3-7-8-4-2-6(14)12(9(3)8)11(5)10(4)7/h3-14H,1-2H2/t3-,4-,5-,6-,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | ISGSXXAFZPIHMC-DQTXGXKNSA-N |
| XLogP | 0.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |