C7H10O2 — CID 124541002
(2S,3R,5R,6S)-tricyclo[2.2.1.02,6]heptane-3,5-diol (PubChem CID 124541002) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (2S,3R,5R,6S)-tricyclo[2.2.1.02,6]heptane-3,5-diol.
| Compound Name | (2S,3R,5R,6S)-tricyclo[2.2.1.02,6]heptane-3,5-diol |
|---|---|
| PubChem CID | 124541002 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (2S,3R,5R,6S)-tricyclo[2.2.1.02,6]heptane-3,5-diol |
| SMILES | O[C@H]1C2CC3[C@H]1[C@H]3[C@H]2O |
| InChI | InChI=1S/C7H10O2/c8-6-3-1-2-4(6)5(2)7(3)9/h2-9H,1H2/t2?,3?,4-,5-,6-,7-/m0/s1 |
| InChIKey | QQLNWTFCRIBMEY-IBJPLQHBSA-N |
| XLogP | -0.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |