C9H12O3 — CID 14344395
(5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl) acetate (PubChem CID 14344395) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl) acetate.
| Compound Name | (5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl) acetate |
|---|---|
| PubChem CID | 14344395 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl) acetate |
| SMILES | CC(=O)OC1C2CC3C(C2O)C31 |
| InChI | InChI=1S/C9H12O3/c1-3(10)12-9-5-2-4-6(7(4)9)8(5)11/h4-9,11H,2H2,1H3 |
| InChIKey | VRYCKVTWYORIOR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |