C10H12O — CID 6565918
(1R,2R,3S,4R,5R,6R,7S,8S,9S)-pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol (PubChem CID 6565918) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R,6R,7S,8S,9S)-pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol.
| Compound Name | (1R,2R,3S,4R,5R,6R,7S,8S,9S)-pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol |
|---|---|
| PubChem CID | 6565918 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (1R,2R,3S,4R,5R,6R,7S,8S,9S)-pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol |
| SMILES | O[C@H]1[C@@H]2[C@@H]3[C@H]4C[C@H]5[C@@H]3[C@@H]2[C@H]5[C@@H]14 |
| InChI | InChI=1S/C10H12O/c11-10-7-3-1-2-4-5(3)9(10)8(4)6(2)7/h2-11H,1H2/t2-,3+,4-,5+,6+,7-,8+,9+,10+/m0/s1 |
| InChIKey | KSRRHRNTPWNNTN-ZVBONYOESA-N |
| XLogP | 0.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |