C12H16O2 — CID 13108252
pentacyclo[5.4.1.03,10.05,9.08,11]dodecane-2,6-diol (PubChem CID 13108252) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is pentacyclo[5.4.1.03,10.05,9.08,11]dodecane-2,6-diol.
| Compound Name | pentacyclo[5.4.1.03,10.05,9.08,11]dodecane-2,6-diol |
|---|---|
| PubChem CID | 13108252 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | pentacyclo[5.4.1.03,10.05,9.08,11]dodecane-2,6-diol |
| SMILES | OC1C2CC3C(O)C4CC1C1C2C3C41 |
| InChI | InChI=1S/C12H16O2/c13-11-3-1-4-8-7(3)9-5(11)2-6(10(8)9)12(4)14/h3-14H,1-2H2 |
| InChIKey | QEWPKZUNKWGTPE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |