C10H14 — CID 124525163
(3R,6R,7S,10S)-tetracyclo[5.3.0.02,6.03,10]decane (PubChem CID 124525163) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (3R,6R,7S,10S)-tetracyclo[5.3.0.02,6.03,10]decane.
| Compound Name | (3R,6R,7S,10S)-tetracyclo[5.3.0.02,6.03,10]decane |
|---|---|
| PubChem CID | 124525163 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (3R,6R,7S,10S)-tetracyclo[5.3.0.02,6.03,10]decane |
| SMILES | C1C[C@@H]2C3C4[C@H](CC[C@@H]42)[C@H]13 |
| InChI | InChI=1S/C10H14/c1-2-6-8-4-3-7-5(1)9(6)10(7)8/h5-10H,1-4H2/t5-,6-,7+,8+,9?,10? |
| InChIKey | NUFMNRYWZHLLTD-XKTNFCBFSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |