C24H28O6 — CID 59360171
(2S,12R,16S,20R)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosane-6,8,17,19-tetrone (PubChem CID 59360171) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (2S,12R,16S,20R)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosane-6,8,17,19-tetrone.
| Compound Name | (2S,12R,16S,20R)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosane-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 59360171 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2S,12R,16S,20R)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosane-6,8,17,19-tetrone |
| SMILES | O=C1OC(=O)C2CC[C@H]3C4CC[C@H]5C(=O)OC(=O)[C@H]6CCC(C4C65)[C@H]4CCC1C2C43 |
| InChI | InChI=1S/C24H28O6/c25-21-13-5-1-9-10-2-6-15-20-16(24(28)30-23(15)27)8-4-12(18(10)20)11-3-7-14(22(26)29-21)19(13)17(9)11/h9-20H,1-8H2/t9-,10?,11+,12?,13?,14?,15+,16-,17?,18?,19?,20? |
| InChIKey | LXSVDDSKAJOORY-OFBRTGGVSA-N |
| XLogP | 2.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|