C18H18O6 — CID 130312731
(3R)-6,14-dioxahexacyclo[9.6.2.13,9.02,10.04,8.012,17]icosane-5,7,13,15-tetrone (PubChem CID 130312731) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3R)-6,14-dioxahexacyclo[9.6.2.13,9.02,10.04,8.012,17]icosane-5,7,13,15-tetrone.
| Compound Name | (3R)-6,14-dioxahexacyclo[9.6.2.13,9.02,10.04,8.012,17]icosane-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 130312731 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3R)-6,14-dioxahexacyclo[9.6.2.13,9.02,10.04,8.012,17]icosane-5,7,13,15-tetrone |
| SMILES | O=C1CC2C3CCC(C2C(=O)O1)C1C2C[C@@H](C4C(=O)OC(=O)C24)C31 |
| InChI | InChI=1S/C18H18O6/c19-10-4-7-5-1-2-6(13(7)16(20)23-10)12-9-3-8(11(5)12)14-15(9)18(22)24-17(14)21/h5-9,11-15H,1-4H2/t5?,6?,7?,8-,9?,11?,12?,13?,14?,15?/m1/s1 |
| InChIKey | DKUAUAFPUJTKGQ-UCRZCEDRSA-N |
| XLogP | 0.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|