C16H14O6 — CID 130369269
(1S,11R)-6,14-dioxahexacyclo[9.5.1.13,9.02,10.04,8.012,16]octadecane-5,7,13,15-tetrone (PubChem CID 130369269) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is (1S,11R)-6,14-dioxahexacyclo[9.5.1.13,9.02,10.04,8.012,16]octadecane-5,7,13,15-tetrone.
| Compound Name | (1S,11R)-6,14-dioxahexacyclo[9.5.1.13,9.02,10.04,8.012,16]octadecane-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 130369269 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (1S,11R)-6,14-dioxahexacyclo[9.5.1.13,9.02,10.04,8.012,16]octadecane-5,7,13,15-tetrone |
| SMILES | O=C1OC(=O)C2C3CC(C12)C1C3[C@H]2C[C@@H]1C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C16H14O6/c17-13-9-3-1-4(10(9)14(18)21-13)8-6-2-5(7(3)8)11-12(6)16(20)22-15(11)19/h3-12H,1-2H2/t3-,4+,5?,6?,7?,8?,9?,10?,11?,12? |
| InChIKey | VAALVBPLSFRYMJ-DJXWPHGHSA-N |
| XLogP | 0.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|