C20H14O12 — CID 157351568
5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 157351568) has the molecular formula C20H14O12 and a molecular weight of 446.32 g/mol. Its IUPAC name is 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 157351568 |
| Molecular Formula | C20H14O12 |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | O=C1OC(=O)C2C1C1C(=O)OC(=O)C21.O=C1OC(=O)C2CC1C1C3CC(C(=O)OC3=O)C21 |
| InChI | InChI=1S/C12H10O6.C8H4O6/c13-9-3-1-4(10(14)17-9)8-6-2-5(7(3)8)11(15)18-12(6)16;9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h3-8H,1-2H2;1-4H |
| InChIKey | BHPDJAMSHLMCOS-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|