C10H8O5 — CID 118582282
4-oxatricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone (PubChem CID 118582282) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is 4-oxatricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone.
| Compound Name | 4-oxatricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 118582282 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4-oxatricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone |
| SMILES | O=C1CC(=O)C2CC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C10H8O5/c11-5-2-6(12)4-1-3(5)7-8(4)10(14)15-9(7)13/h3-4,7-8H,1-2H2 |
| InChIKey | RGUDEQZRFJQVFP-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|