C22H20O11 — CID 158257387
5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;methane;4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 158257387) has the molecular formula C22H20O11 and a molecular weight of 460.39 g/mol. Its IUPAC name is 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;methane;4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;methane;4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 158257387 |
| Molecular Formula | C22H20O11 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10,12-tetrone;methane;4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | C.O=C1CC(=O)C2C1C1C(=O)OC(=O)C21.O=C1OC(=O)C2CC1C1C3CC(C(=O)OC3=O)C21 |
| InChI | InChI=1S/C12H10O6.C9H6O5.CH4/c13-9-3-1-4(10(14)17-9)8-6-2-5(7(3)8)11(15)18-12(6)16;10-2-1-3(11)5-4(2)6-7(5)9(13)14-8(6)12;/h3-8H,1-2H2;4-7H,1H2;1H4 |
| InChIKey | GHLIUBOTJLGCJV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|