C13H14O6 — CID 144980589
5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10-trione;formaldehyde (PubChem CID 144980589) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10-trione;formaldehyde.
| Compound Name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10-trione;formaldehyde |
|---|---|
| PubChem CID | 144980589 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5,11-dioxatetracyclo[7.3.1.13,7.02,8]tetradecane-4,6,10-trione;formaldehyde |
| SMILES | C=O.O=C1OC(=O)C2CC1C1C3COC(=O)C(C3)C21 |
| InChI | InChI=1S/C12H12O5.CH2O/c13-10-5-1-4(3-16-10)8-6-2-7(9(5)8)12(15)17-11(6)14;1-2/h4-9H,1-3H2;1H2 |
| InChIKey | GKSCAWKLKCCULX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|