C11H10O5 — CID 90181079
5-methylidene-3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,7-trione (PubChem CID 90181079) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 5-methylidene-3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,7-trione.
| Compound Name | 5-methylidene-3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,7-trione |
|---|---|
| PubChem CID | 90181079 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-methylidene-3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,7-trione |
| SMILES | C=C1OC(=O)C2CC3C(=O)OC(=O)C3CC12 |
| InChI | InChI=1S/C11H10O5/c1-4-5-2-7-8(11(14)16-10(7)13)3-6(5)9(12)15-4/h5-8H,1-3H2 |
| InChIKey | PYCQRXNSPWWTHK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|