C23H24O12 — CID 162206832
3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone;methane;1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 162206832) has the molecular formula C23H24O12 and a molecular weight of 492.43 g/mol. Its IUPAC name is 3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone;methane;1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone;methane;1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 162206832 |
| Molecular Formula | C23H24O12 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone;methane;1,2,6,7-tetramethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | C.CC12C(=O)OC(=O)C1(C)C1(C)C(=O)OC(=O)C21C.O=C1OC(=O)C2CC3C(=O)OC(=O)C3CC12 |
| InChI | InChI=1S/C12H12O6.C10H8O6.CH4/c1-9-5(13)17-6(14)10(9,2)12(4)8(16)18-7(15)11(9,12)3;11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7;/h1-4H3;3-6H,1-2H2;1H4 |
| InChIKey | ZSHNODSMZKDUDH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|