C14H14O6 — CID 139050845
(1R,4R,8S,11S)-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadecane-5,7,12,14-tetrone (PubChem CID 139050845) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is (1R,4R,8S,11S)-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadecane-5,7,12,14-tetrone.
| Compound Name | (1R,4R,8S,11S)-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadecane-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 139050845 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (1R,4R,8S,11S)-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadecane-5,7,12,14-tetrone |
| SMILES | O=C1OC(=O)[C@@H]2CC[C@H]3C(=O)OC(=O)[C@H]4CC[C@H]1C2C43 |
| InChI | InChI=1S/C14H14O6/c15-11-5-1-2-6-10-8(14(18)20-12(6)16)4-3-7(9(5)10)13(17)19-11/h5-10H,1-4H2/t5-,6-,7+,8+,9?,10? |
| InChIKey | XFVAJDUPUAVANC-XKTNFCBFSA-N |
| XLogP | 0.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|