C8H14N2O3 — CID 159173546
3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione;hydrazine (PubChem CID 159173546) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione;hydrazine.
| Compound Name | 3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione;hydrazine |
|---|---|
| PubChem CID | 159173546 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione;hydrazine |
| SMILES | NN.O=C1OC(=O)C2CCCCC12 |
| InChI | InChI=1S/C8H10O3.H4N2/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2/h5-6H,1-4H2;1-2H2 |
| InChIKey | KLZLTAOIHCKAEK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|