C16H18O7S — CID 58986493
5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)sulfinyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (PubChem CID 58986493) has the molecular formula C16H18O7S and a molecular weight of 354.38 g/mol. Its IUPAC name is 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)sulfinyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)sulfinyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 58986493 |
| Molecular Formula | C16H18O7S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl)sulfinyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2CC(S(=O)C3CCC4C(=O)OC(=O)C4C3)CCC12 |
| InChI | InChI=1S/C16H18O7S/c17-13-9-3-1-7(5-11(9)15(19)22-13)24(21)8-2-4-10-12(6-8)16(20)23-14(10)18/h7-12H,1-6H2 |
| InChIKey | WTYITWJOHWJDLW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|