C11H10O5 — CID 18716512
3a,4,4a,7a,8,8a-hexahydrocyclopenta[f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 18716512) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 3a,4,4a,7a,8,8a-hexahydrocyclopenta[f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 3a,4,4a,7a,8,8a-hexahydrocyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 18716512 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3a,4,4a,7a,8,8a-hexahydrocyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1CC(=O)C2CC3C(=O)OC(=O)C3CC12 |
| InChI | InChI=1S/C11H10O5/c12-8-3-9(13)5-2-7-6(1-4(5)8)10(14)16-11(7)15/h4-7H,1-3H2 |
| InChIKey | CSBRIWHWEPJDPE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|