C9H10O3 — CID 58288598
1a,2,2a,5a,6,6a-hexahydroindeno[5,6-b]oxirene-3,5-dione (PubChem CID 58288598) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1a,2,2a,5a,6,6a-hexahydroindeno[5,6-b]oxirene-3,5-dione.
| Compound Name | 1a,2,2a,5a,6,6a-hexahydroindeno[5,6-b]oxirene-3,5-dione |
|---|---|
| PubChem CID | 58288598 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 1a,2,2a,5a,6,6a-hexahydroindeno[5,6-b]oxirene-3,5-dione |
| SMILES | O=C1CC(=O)C2CC3OC3CC12 |
| InChI | InChI=1S/C9H10O3/c10-6-3-7(11)5-2-9-8(12-9)1-4(5)6/h4-5,8-9H,1-3H2 |
| InChIKey | AZRFILHQMYSKEA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|