C16H22O2 — CID 144517587
3,5-dimethylidene-3a,4,4a,7a,8,8a-hexahydro-s-indacene-1,7-dione;ethane (PubChem CID 144517587) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3,5-dimethylidene-3a,4,4a,7a,8,8a-hexahydro-s-indacene-1,7-dione;ethane.
| Compound Name | 3,5-dimethylidene-3a,4,4a,7a,8,8a-hexahydro-s-indacene-1,7-dione;ethane |
|---|---|
| PubChem CID | 144517587 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3,5-dimethylidene-3a,4,4a,7a,8,8a-hexahydro-s-indacene-1,7-dione;ethane |
| SMILES | C=C1CC(=O)C2CC3C(=O)CC(=C)C3CC12.CC |
| InChI | InChI=1S/C14H16O2.C2H6/c1-7-3-13(15)11-6-12-10(5-9(7)11)8(2)4-14(12)16;1-2/h9-12H,1-6H2;1-2H3 |
| InChIKey | RIYIKYMARZGHBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|