C15H18O4 — CID 154927024
methyl 5-formyl-10-methylidene-8-oxotricyclo[5.3.1.02,6]undecane-3-carboxylate (PubChem CID 154927024) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is methyl 5-formyl-10-methylidene-8-oxotricyclo[5.3.1.02,6]undecane-3-carboxylate.
| Compound Name | methyl 5-formyl-10-methylidene-8-oxotricyclo[5.3.1.02,6]undecane-3-carboxylate |
|---|---|
| PubChem CID | 154927024 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 5-formyl-10-methylidene-8-oxotricyclo[5.3.1.02,6]undecane-3-carboxylate |
| SMILES | C=C1CC(=O)C2CC1C1C(C(=O)OC)CC(C=O)C21 |
| InChI | InChI=1S/C15H18O4/c1-7-3-12(17)10-5-9(7)14-11(15(18)19-2)4-8(6-16)13(10)14/h6,8-11,13-14H,1,3-5H2,2H3 |
| InChIKey | MNRQPRVHMMEOKE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|