C11H10O4 — CID 141160354
tricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone (PubChem CID 141160354) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is tricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone.
| Compound Name | tricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 141160354 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | tricyclo[5.3.1.02,6]undecane-3,5,8,10-tetrone |
| SMILES | O=C1CC(=O)C2CC1C1C(=O)CC(=O)C21 |
| InChI | InChI=1S/C11H10O4/c12-6-2-7(13)5-1-4(6)10-8(14)3-9(15)11(5)10/h4-5,10-11H,1-3H2 |
| InChIKey | QBCKOLIPDJXEFG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|