C11H14ClNO3 — CID 86637149
4-(3-chloropropyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione (PubChem CID 86637149) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-(3-chloropropyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione.
| Compound Name | 4-(3-chloropropyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
|---|---|
| PubChem CID | 86637149 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-(3-chloropropyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
| SMILES | O=C1C2CC3OC3CC2C(=O)N1CCCCl |
| InChI | InChI=1S/C11H14ClNO3/c12-2-1-3-13-10(14)6-4-8-9(16-8)5-7(6)11(13)15/h6-9H,1-5H2 |
| InChIKey | JCMOAGXLADNIKY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|