C9H10N2O2 — CID 62666655
4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)butanenitrile (PubChem CID 62666655) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)butanenitrile.
| Compound Name | 4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)butanenitrile |
|---|---|
| PubChem CID | 62666655 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)butanenitrile |
| SMILES | N#CCCCN1C(=O)C2CC2C1=O |
| InChI | InChI=1S/C9H10N2O2/c10-3-1-2-4-11-8(12)6-5-7(6)9(11)13/h6-7H,1-2,4-5H2 |
| InChIKey | LBHRKOJMLUGSJS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|