C10H16N2O4S — CID 136518272
3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N,N-dimethylpropane-1-sulfonamide (PubChem CID 136518272) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 136518272 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCN1C(=O)C2CC2C1=O |
| InChI | InChI=1S/C10H16N2O4S/c1-11(2)17(15,16)5-3-4-12-9(13)7-6-8(7)10(12)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | WCONOCNADBRBAQ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|