C13H27Cl2N3O2S — CID 154910770
3-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride (PubChem CID 154910770) has the molecular formula C13H27Cl2N3O2S and a molecular weight of 360.35 g/mol. Its IUPAC name is 3-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride.
| Compound Name | 3-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 154910770 |
| Molecular Formula | C13H27Cl2N3O2S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride |
| SMILES | CN(C)S(=O)(=O)CCCN1[C@@H]2CC[C@H]1[C@H]1CNC[C@H]12.Cl.Cl |
| InChI | InChI=1S/C13H25N3O2S.2ClH/c1-15(2)19(17,18)7-3-6-16-12-4-5-13(16)11-9-14-8-10(11)12;;/h10-14H,3-9H2,1-2H3;2*1H/t10-,11+,12-,13+;; |
| InChIKey | UWXWNSMUWYKTLH-NRKRBZPGSA-N |
| XLogP | 0.79 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |